C41H51N5S3 — CID 167359352
4-[4-[2-[4-(dihexylamino)phenyl]thieno[3,2-b]thiophen-5-yl]-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]-N-hexylaniline (PubChem CID 167359352) has the molecular formula C41H51N5S3 and a molecular weight of 710.10 g/mol. Its IUPAC name is 4-[4-[2-[4-(dihexylamino)phenyl]thieno[3,2-b]thiophen-5-yl]-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]-N-hexylaniline.
| Compound Name | 4-[4-[2-[4-(dihexylamino)phenyl]thieno[3,2-b]thiophen-5-yl]-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]-N-hexylaniline |
|---|---|
| PubChem CID | 167359352 |
| Molecular Formula | C41H51N5S3 |
| Molecular Weight | 710.10 g/mol |
| Exact Mass | 709.33 |
| IUPAC Name | 4-[4-[2-[4-(dihexylamino)phenyl]thieno[3,2-b]thiophen-5-yl]-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]-N-hexylaniline |
| SMILES | CCCCCCNc1ccc(-c2cnc(-c3cc4sc(-c5ccc(N(CCCCCC)CCCCCC)cc5)cc4s3)c3nsnc23)cc1 |
| InChI | InChI=1S/C41H51N5S3/c1-4-7-10-13-24-42-32-20-16-30(17-21-32)34-29-43-40(41-39(34)44-49-45-41)38-28-37-36(48-38)27-35(47-37)31-18-22-33(23-19-31)46(25-14-11-8-5-2)26-15-12-9-6-3/h16-23,27-29,42H,4-15,24-26H2,1-3H3 |
| InChIKey | XJQWNKVBEPZSST-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.10 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|