C19H20O4S — CID 167359990
(10,10-dioxo-9H-thioxanthen-9-yl)methyl 2,2-dimethylpropanoate (PubChem CID 167359990) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is (10,10-dioxo-9H-thioxanthen-9-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (10,10-dioxo-9H-thioxanthen-9-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 167359990 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (10,10-dioxo-9H-thioxanthen-9-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C19H20O4S/c1-19(2,3)18(20)23-12-15-13-8-4-6-10-16(13)24(21,22)17-11-7-5-9-14(15)17/h4-11,15H,12H2,1-3H3 |
| InChIKey | FTRSCZIDZJABMO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |