About 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile
2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile (PubChem CID 167360209) has the molecular formula C16H11ClF2N2
and a molecular weight of 304.73 g/mol. Its IUPAC name is 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile.
Molecular Properties
| Compound Name | 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile |
| PubChem CID | 167360209 |
| Molecular Formula | C16H11ClF2N2 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile |
| SMILES | N#CC(/N=C/c1ccccc1)C(F)(F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClF2N2/c17-14-8-6-13(7-9-14)16(18,19)15(10-20)21-11-12-4-2-1-3-5-12/h1-9,11,15H/b21-11+ |
| InChIKey | OCJSBVCQPFCMMB-SRZZPIQSSA-N |
| XLogP | 4.44 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile?
The IUPAC name of 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile (CID 167360209) is 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile.
What is the SMILES notation for 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile?
The canonical SMILES for 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile is N#CC(/N=C/c1ccccc1)C(F)(F)c1ccc(Cl)cc1.
What is the InChIKey of 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile?
The InChIKey is OCJSBVCQPFCMMB-SRZZPIQSSA-N. The full InChI is InChI=1S/C16H11ClF2N2/c17-14-8-6-13(7-9-14)16(18,19)15(10-20)21-11-12-4-2-1-3-5-12/h1-9,11,15H/b21-11+.
What are the key properties of 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile?
2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile has a molecular weight of 304.73 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile is sourced from PubChem (CID 167360209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).