C16H11ClF2N2 — CID 167360209
2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile (PubChem CID 167360209) has the molecular formula C16H11ClF2N2 and a molecular weight of 304.73 g/mol. Its IUPAC name is 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile.
| Compound Name | 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile |
|---|---|
| PubChem CID | 167360209 |
| Molecular Formula | C16H11ClF2N2 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(benzylideneamino)-3-(4-chlorophenyl)-3,3-difluoropropanenitrile |
| SMILES | N#CC(/N=C/c1ccccc1)C(F)(F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClF2N2/c17-14-8-6-13(7-9-14)16(18,19)15(10-20)21-11-12-4-2-1-3-5-12/h1-9,11,15H/b21-11+ |
| InChIKey | OCJSBVCQPFCMMB-SRZZPIQSSA-N |
| XLogP | 4.44 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|