C75H53N3 — CID 167363865
4-(3,5-diphenylcyclohexa-1,5-dien-1-yl)-6-(3,5-diphenylphenyl)-2-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine (PubChem CID 167363865) has the molecular formula C75H53N3 and a molecular weight of 996.27 g/mol. Its IUPAC name is 4-(3,5-diphenylcyclohexa-1,5-dien-1-yl)-6-(3,5-diphenylphenyl)-2-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine.
| Compound Name | 4-(3,5-diphenylcyclohexa-1,5-dien-1-yl)-6-(3,5-diphenylphenyl)-2-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 167363865 |
| Molecular Formula | C75H53N3 |
| Molecular Weight | 996.27 g/mol |
| Exact Mass | 995.42 |
| IUPAC Name | 4-(3,5-diphenylcyclohexa-1,5-dien-1-yl)-6-(3,5-diphenylphenyl)-2-[3-(2,3,5,6-tetraphenyl-4-pyridinyl)phenyl]pyrimidine |
| SMILES | C1=C(c2ccccc2)CC(c2ccccc2)C=C1c1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)nc(-c2cccc(-c3c(-c4ccccc4)c(-c4ccccc4)nc(-c4ccccc4)c3-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C75H53N3/c1-9-26-52(27-10-1)62-45-63(53-28-11-2-12-29-53)48-66(47-62)68-51-69(67-49-64(54-30-13-3-14-31-54)46-65(50-67)55-32-15-4-16-33-55)77-75(76-68)61-43-25-42-60(44-61)70-71(56-34-17-5-18-35-56)73(58-38-21-7-22-39-58)78-74(59-40-23-8-24-41-59)72(70)57-36-19-6-20-37-57/h1-45,47-51,64H,46H2 |
| InChIKey | NQIUDRVFCIVMKE-UHFFFAOYSA-N |
| XLogP | 19.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.27 |
| LogP ≤ 5 | 19.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |