C32H22Cl2N6O3 — CID 167366137
2-[[5-chloro-7-[5-[5-chloro-3-(cyclopropylmethyl)-2-isocyanophenyl]-1-methylpyrazol-4-yl]-4-oxo-3H-phthalazin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 167366137) has the molecular formula C32H22Cl2N6O3 and a molecular weight of 609.47 g/mol. Its IUPAC name is 2-[[5-chloro-7-[5-[5-chloro-3-(cyclopropylmethyl)-2-isocyanophenyl]-1-methylpyrazol-4-yl]-4-oxo-3H-phthalazin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-chloro-7-[5-[5-chloro-3-(cyclopropylmethyl)-2-isocyanophenyl]-1-methylpyrazol-4-yl]-4-oxo-3H-phthalazin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167366137 |
| Molecular Formula | C32H22Cl2N6O3 |
| Molecular Weight | 609.47 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | 2-[[5-chloro-7-[5-[5-chloro-3-(cyclopropylmethyl)-2-isocyanophenyl]-1-methylpyrazol-4-yl]-4-oxo-3H-phthalazin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | [C-]#[N+]c1c(CC2CC2)cc(Cl)cc1-c1c(-c2cc(Cl)c3c(=O)[nH]nc(CN4C(=O)c5ccccc5C4=O)c3c2)cnn1C |
| InChI | InChI=1S/C32H22Cl2N6O3/c1-35-28-18(9-16-7-8-16)10-19(33)13-23(28)29-24(14-36-39(29)2)17-11-22-26(37-38-30(41)27(22)25(34)12-17)15-40-31(42)20-5-3-4-6-21(20)32(40)43/h3-6,10-14,16H,7-9,15H2,2H3,(H,38,41) |
| InChIKey | WDKDZOGYNWGHPH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.47 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|