C10H7F3N3+ — CID 167377425
4-(trifluoromethyl)-5,6-diaza-8-azoniatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene (PubChem CID 167377425) has the molecular formula C10H7F3N3+ and a molecular weight of 226.18 g/mol. Its IUPAC name is 4-(trifluoromethyl)-5,6-diaza-8-azoniatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene.
| Compound Name | 4-(trifluoromethyl)-5,6-diaza-8-azoniatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene |
|---|---|
| PubChem CID | 167377425 |
| Molecular Formula | C10H7F3N3+ |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-(trifluoromethyl)-5,6-diaza-8-azoniatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene |
| SMILES | FC(F)(F)c1cc2n(n1)C[n+]1ccccc1-2 |
| InChI | InChI=1S/C10H7F3N3/c11-10(12,13)9-5-8-7-3-1-2-4-15(7)6-16(8)14-9/h1-5H,6H2/q+1 |
| InChIKey | OTABUOXHMGCHOH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|