C19H23N5O8P2 — CID 16737932
[(1R,2S,4R,5S)-4-[6-(methylamino)-2-phenylpurin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate (PubChem CID 16737932) has the molecular formula C19H23N5O8P2 and a molecular weight of 511.37 g/mol. Its IUPAC name is [(1R,2S,4R,5S)-4-[6-(methylamino)-2-phenylpurin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,2S,4R,5S)-4-[6-(methylamino)-2-phenylpurin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 16737932 |
| Molecular Formula | C19H23N5O8P2 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | [(1R,2S,4R,5S)-4-[6-(methylamino)-2-phenylpurin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
| SMILES | CNc1nc(-c2ccccc2)nc2c1ncn2[C@@H]1C[C@H](OP(=O)(O)O)[C@]2(COP(=O)(O)O)C[C@H]12 |
| InChI | InChI=1S/C19H23N5O8P2/c1-20-17-15-18(23-16(22-17)11-5-3-2-4-6-11)24(10-21-15)13-7-14(32-34(28,29)30)19(8-12(13)19)9-31-33(25,26)27/h2-6,10,12-14H,7-9H2,1H3,(H,20,22,23)(H2,25,26,27)(H2,28,29,30)/t12-,13-,14+,19+/m1/s1 |
| InChIKey | OFUMALJRWRDDLP-PXWIGAEESA-N |
| XLogP | 2.07 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|