C15H19ClN5O6P — CID 11092692
[(1R,2S,4S,5S)-4-[2-chloro-6-(methylamino)purin-9-yl]-1-(phosphonooxymethyl)-2-bicyclo[3.1.0]hexanyl] acetate (PubChem CID 11092692) has the molecular formula C15H19ClN5O6P and a molecular weight of 431.77 g/mol. Its IUPAC name is [(1R,2S,4S,5S)-4-[2-chloro-6-(methylamino)purin-9-yl]-1-(phosphonooxymethyl)-2-bicyclo[3.1.0]hexanyl] acetate.
| Compound Name | [(1R,2S,4S,5S)-4-[2-chloro-6-(methylamino)purin-9-yl]-1-(phosphonooxymethyl)-2-bicyclo[3.1.0]hexanyl] acetate |
|---|---|
| PubChem CID | 11092692 |
| Molecular Formula | C15H19ClN5O6P |
| Molecular Weight | 431.77 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [(1R,2S,4S,5S)-4-[2-chloro-6-(methylamino)purin-9-yl]-1-(phosphonooxymethyl)-2-bicyclo[3.1.0]hexanyl] acetate |
| SMILES | CNc1nc(Cl)nc2c1ncn2[C@H]1C[C@H](OC(C)=O)[C@]2(COP(=O)(O)O)C[C@H]12 |
| InChI | InChI=1S/C15H19ClN5O6P/c1-7(22)27-10-3-9(8-4-15(8,10)5-26-28(23,24)25)21-6-18-11-12(17-2)19-14(16)20-13(11)21/h6,8-10H,3-5H2,1-2H3,(H,17,19,20)(H2,23,24,25)/t8-,9+,10+,15+/m1/s1 |
| InChIKey | QIHFSNBMUUILFV-HTQGBYLWSA-N |
| XLogP | 1.51 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.77 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|