C12H14ClIN4O8P2 — CID 11455839
[(1S,2S,4S,5S)-4-(6-chloro-2-iodopurin-9-yl)-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate (PubChem CID 11455839) has the molecular formula C12H14ClIN4O8P2 and a molecular weight of 566.57 g/mol. Its IUPAC name is [(1S,2S,4S,5S)-4-(6-chloro-2-iodopurin-9-yl)-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate.
| Compound Name | [(1S,2S,4S,5S)-4-(6-chloro-2-iodopurin-9-yl)-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 11455839 |
| Molecular Formula | C12H14ClIN4O8P2 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 565.90 |
| IUPAC Name | [(1S,2S,4S,5S)-4-(6-chloro-2-iodopurin-9-yl)-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@]12C[C@@H]1[C@@H](n1cnc3c(Cl)nc(I)nc31)C[C@@H]2OP(=O)(O)O |
| InChI | InChI=1S/C12H14ClIN4O8P2/c13-9-8-10(17-11(14)16-9)18(4-15-8)6-1-7(26-28(22,23)24)12(2-5(6)12)3-25-27(19,20)21/h4-7H,1-3H2,(H2,19,20,21)(H2,22,23,24)/t5-,6+,7+,12-/m1/s1 |
| InChIKey | GLHPPJBPXJKOQH-LMDRRUJSSA-N |
| XLogP | 1.62 |
| TPSA | 177.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|