C33H55ClN4O8P2Si — CID 16734989
[(1R,2S,4R,5S)-2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-4-[6-chloro-2-(2-trimethylsilylethynyl)purin-9-yl]-1-bicyclo[3.1.0]hexanyl]methyl ditert-butyl phosphate (PubChem CID 16734989) has the molecular formula C33H55ClN4O8P2Si and a molecular weight of 761.31 g/mol. Its IUPAC name is [(1R,2S,4R,5S)-2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-4-[6-chloro-2-(2-trimethylsilylethynyl)purin-9-yl]-1-bicyclo[3.1.0]hexanyl]methyl ditert-butyl phosphate.
| Compound Name | [(1R,2S,4R,5S)-2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-4-[6-chloro-2-(2-trimethylsilylethynyl)purin-9-yl]-1-bicyclo[3.1.0]hexanyl]methyl ditert-butyl phosphate |
|---|---|
| PubChem CID | 16734989 |
| Molecular Formula | C33H55ClN4O8P2Si |
| Molecular Weight | 761.31 g/mol |
| Exact Mass | 760.30 |
| IUPAC Name | [(1R,2S,4R,5S)-2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-4-[6-chloro-2-(2-trimethylsilylethynyl)purin-9-yl]-1-bicyclo[3.1.0]hexanyl]methyl ditert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OC[C@@]12C[C@@H]1[C@H](n1cnc3c(Cl)nc(C#C[Si](C)(C)C)nc31)C[C@@H]2OP(=O)(OC(C)(C)C)OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C33H55ClN4O8P2Si/c1-29(2,3)43-47(39,44-30(4,5)6)41-20-33-19-22(33)23(18-24(33)42-48(40,45-31(7,8)9)46-32(10,11)12)38-21-35-26-27(34)36-25(37-28(26)38)16-17-49(13,14)15/h21-24H,18-20H2,1-15H3/t22-,23-,24+,33+/m1/s1 |
| InChIKey | YVPVOOHHPBJORE-ZHGQOYCDSA-N |
| XLogP | 9.54 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.31 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|