C18H23N5O8P2 — CID 87667874
[4-[2-(4-methoxy-4-oxobut-1-ynyl)-6-(methylamino)purin-9-yl]-2-phosphono-1-bicyclo[3.1.0]hexanyl]methylphosphonic acid (PubChem CID 87667874) has the molecular formula C18H23N5O8P2 and a molecular weight of 499.36 g/mol. Its IUPAC name is [4-[2-(4-methoxy-4-oxobut-1-ynyl)-6-(methylamino)purin-9-yl]-2-phosphono-1-bicyclo[3.1.0]hexanyl]methylphosphonic acid.
| Compound Name | [4-[2-(4-methoxy-4-oxobut-1-ynyl)-6-(methylamino)purin-9-yl]-2-phosphono-1-bicyclo[3.1.0]hexanyl]methylphosphonic acid |
|---|---|
| PubChem CID | 87667874 |
| Molecular Formula | C18H23N5O8P2 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [4-[2-(4-methoxy-4-oxobut-1-ynyl)-6-(methylamino)purin-9-yl]-2-phosphono-1-bicyclo[3.1.0]hexanyl]methylphosphonic acid |
| SMILES | CNc1nc(C#CCC(=O)OC)nc2c1ncn2C1CC(P(=O)(O)O)C2(CP(=O)(O)O)CC12 |
| InChI | InChI=1S/C18H23N5O8P2/c1-19-16-15-17(22-13(21-16)4-3-5-14(24)31-2)23(9-20-15)11-6-12(33(28,29)30)18(7-10(11)18)8-32(25,26)27/h9-12H,5-8H2,1-2H3,(H,19,21,22)(H2,25,26,27)(H2,28,29,30) |
| InChIKey | FBRKFGHUNCFNDU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|