C13H19N5O8P2 — CID 58758365
[(2S,4S,5S)-4-[6-(methylamino)purin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate (PubChem CID 58758365) has the molecular formula C13H19N5O8P2 and a molecular weight of 435.27 g/mol. Its IUPAC name is [(2S,4S,5S)-4-[6-(methylamino)purin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate.
| Compound Name | [(2S,4S,5S)-4-[6-(methylamino)purin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 58758365 |
| Molecular Formula | C13H19N5O8P2 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | [(2S,4S,5S)-4-[6-(methylamino)purin-9-yl]-2-phosphonooxy-1-bicyclo[3.1.0]hexanyl]methyl dihydrogen phosphate |
| SMILES | CNc1ncnc2c1ncn2[C@H]1C[C@H](OP(=O)(O)O)C2(COP(=O)(O)O)C[C@H]12 |
| InChI | InChI=1S/C13H19N5O8P2/c1-14-11-10-12(16-5-15-11)18(6-17-10)8-2-9(26-28(22,23)24)13(3-7(8)13)4-25-27(19,20)21/h5-9H,2-4H2,1H3,(H,14,15,16)(H2,19,20,21)(H2,22,23,24)/t7-,8+,9+,13?/m1/s1 |
| InChIKey | FQABQZAJQNHBSV-OTBBMYEOSA-N |
| XLogP | 0.41 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|