About 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one
3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one (PubChem CID 167387482) has the molecular formula C20H14F6N2O2
and a molecular weight of 428.33 g/mol. Its IUPAC name is 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one.
Molecular Properties
| Compound Name | 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one |
| PubChem CID | 167387482 |
| Molecular Formula | C20H14F6N2O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one |
| SMILES | CN(C)c1ccc2nc(C=Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C20H14F6N2O2/c1-28(2)13-6-8-15-17(10-13)30-18(29)16(27-15)7-4-11-3-5-12(19(21,22)23)9-14(11)20(24,25)26/h3-10H,1-2H3 |
| InChIKey | ZVJCLPCFEWCTDF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one?
The IUPAC name of 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one (CID 167387482) is 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one.
What is the SMILES notation for 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one?
The canonical SMILES for 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one is CN(C)c1ccc2nc(C=Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c(=O)oc2c1.
What is the InChIKey of 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one?
The InChIKey is ZVJCLPCFEWCTDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F6N2O2/c1-28(2)13-6-8-15-17(10-13)30-18(29)16(27-15)7-4-11-3-5-12(19(21,22)23)9-14(11)20(24,25)26/h3-10H,1-2H3.
What are the key properties of 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one?
3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one has a molecular weight of 428.33 g/mol, XLogP of 5.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2,4-bis(trifluoromethyl)phenyl]ethenyl]-7-(dimethylamino)-1,4-benzoxazin-2-one is sourced from PubChem (CID 167387482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).