C29H22ClF4N3O4 — CID 16739915
4-[[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]benzoic acid (PubChem CID 16739915) has the molecular formula C29H22ClF4N3O4 and a molecular weight of 587.96 g/mol. Its IUPAC name is 4-[[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]benzoic acid.
| Compound Name | 4-[[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 16739915 |
| Molecular Formula | C29H22ClF4N3O4 |
| Molecular Weight | 587.96 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 4-[[(1R)-1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)cc1)N[C@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C29H22ClF4N3O4/c30-21-11-14-24(35-17-21)28(16-18-5-2-1-3-6-18,20-7-4-8-23(15-20)41-29(33,34)26(31)32)37-27(40)36-22-12-9-19(10-13-22)25(38)39/h1-15,17,26H,16H2,(H,38,39)(H2,36,37,40)/t28-/m1/s1 |
| InChIKey | PXCABVCPSJJVNJ-MUUNZHRXSA-N |
| XLogP | 6.98 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.96 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|