C14H12ClIO2 — CID 16741994
1-(2-chlorophenyl)-4-iodo-2,5-dimethoxybenzene (PubChem CID 16741994) has the molecular formula C14H12ClIO2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-iodo-2,5-dimethoxybenzene.
| Compound Name | 1-(2-chlorophenyl)-4-iodo-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 16741994 |
| Molecular Formula | C14H12ClIO2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 1-(2-chlorophenyl)-4-iodo-2,5-dimethoxybenzene |
| SMILES | COc1cc(-c2ccccc2Cl)c(OC)cc1I |
| InChI | InChI=1S/C14H12ClIO2/c1-17-13-8-12(16)14(18-2)7-10(13)9-5-3-4-6-11(9)15/h3-8H,1-2H3 |
| InChIKey | HRTRZYQLVXEMPF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|