C30H61NO11 — CID 167420722
1-[1,3-bis[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-ylamino]-3-methylbutan-2-one (PubChem CID 167420722) has the molecular formula C30H61NO11 and a molecular weight of 611.81 g/mol. Its IUPAC name is 1-[1,3-bis[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-ylamino]-3-methylbutan-2-one.
| Compound Name | 1-[1,3-bis[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-ylamino]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 167420722 |
| Molecular Formula | C30H61NO11 |
| Molecular Weight | 611.81 g/mol |
| Exact Mass | 611.42 |
| IUPAC Name | 1-[1,3-bis[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-ylamino]-3-methylbutan-2-one |
| SMILES | CC(C)OCCOCCOCCOCCOCC(COCCOCCOCCOCCOC(C)C)NCC(=O)C(C)C |
| InChI | InChI=1S/C30H61NO11/c1-26(2)30(32)23-31-29(24-39-17-15-35-9-7-33-11-13-37-19-21-41-27(3)4)25-40-18-16-36-10-8-34-12-14-38-20-22-42-28(5)6/h26-29,31H,7-25H2,1-6H3 |
| InChIKey | WHYWFFFRAWXJTG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|