C19H40N2O6S — CID 170381769
2-methyl-7-[2-[2-(3-methylpentoxy)ethoxy]ethoxy]-6-(methylsulfamoylamino)heptan-3-one (PubChem CID 170381769) has the molecular formula C19H40N2O6S and a molecular weight of 424.60 g/mol. Its IUPAC name is 2-methyl-7-[2-[2-(3-methylpentoxy)ethoxy]ethoxy]-6-(methylsulfamoylamino)heptan-3-one.
| Compound Name | 2-methyl-7-[2-[2-(3-methylpentoxy)ethoxy]ethoxy]-6-(methylsulfamoylamino)heptan-3-one |
|---|---|
| PubChem CID | 170381769 |
| Molecular Formula | C19H40N2O6S |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-methyl-7-[2-[2-(3-methylpentoxy)ethoxy]ethoxy]-6-(methylsulfamoylamino)heptan-3-one |
| SMILES | CCC(C)CCOCCOCCOCC(CCC(=O)C(C)C)NS(=O)(=O)NC |
| InChI | InChI=1S/C19H40N2O6S/c1-6-17(4)9-10-25-11-12-26-13-14-27-15-18(21-28(23,24)20-5)7-8-19(22)16(2)3/h16-18,20-21H,6-15H2,1-5H3 |
| InChIKey | YUKDOGOTBYQWNK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|