C22H45NO7 — CID 167420848
1-[1,3-bis[2-(2-propan-2-yloxyethoxy)ethoxy]propan-2-ylamino]-3-methylbutan-2-one (PubChem CID 167420848) has the molecular formula C22H45NO7 and a molecular weight of 435.60 g/mol. Its IUPAC name is 1-[1,3-bis[2-(2-propan-2-yloxyethoxy)ethoxy]propan-2-ylamino]-3-methylbutan-2-one.
| Compound Name | 1-[1,3-bis[2-(2-propan-2-yloxyethoxy)ethoxy]propan-2-ylamino]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 167420848 |
| Molecular Formula | C22H45NO7 |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | 1-[1,3-bis[2-(2-propan-2-yloxyethoxy)ethoxy]propan-2-ylamino]-3-methylbutan-2-one |
| SMILES | CC(C)OCCOCCOCC(COCCOCCOC(C)C)NCC(=O)C(C)C |
| InChI | InChI=1S/C22H45NO7/c1-18(2)22(24)15-23-21(16-27-9-7-25-11-13-29-19(3)4)17-28-10-8-26-12-14-30-20(5)6/h18-21,23H,7-17H2,1-6H3 |
| InChIKey | MXACOORXACWZFG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|