About [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride
[2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride (PubChem CID 167430597) has the molecular formula C23H32ClNO2
and a molecular weight of 389.97 g/mol. Its IUPAC name is [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride.
Molecular Properties
| Compound Name | [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride |
| PubChem CID | 167430597 |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride |
| SMILES | CC(C)Cc1cccc(C(=O)[N+](C)(C)Oc2ccccc2)c1CC(C)C.[Cl-] |
| InChI | InChI=1S/C23H32NO2.ClH/c1-17(2)15-19-11-10-14-21(22(19)16-18(3)4)23(25)24(5,6)26-20-12-8-7-9-13-20;/h7-14,17-18H,15-16H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | XESRSECVJZNGAM-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride?
The IUPAC name of [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride (CID 167430597) is [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride.
What is the SMILES notation for [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride?
The canonical SMILES for [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride is CC(C)Cc1cccc(C(=O)[N+](C)(C)Oc2ccccc2)c1CC(C)C.[Cl-].
What is the InChIKey of [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride?
The InChIKey is XESRSECVJZNGAM-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H32NO2.ClH/c1-17(2)15-19-11-10-14-21(22(19)16-18(3)4)23(25)24(5,6)26-20-12-8-7-9-13-20;/h7-14,17-18H,15-16H2,1-6H3;1H/q+1;/p-1.
What are the key properties of [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride?
[2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride has a molecular weight of 389.97 g/mol, XLogP of 2.30, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium chloride is sourced from PubChem (CID 167430597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).