C23H32NO2+ — CID 167430598
[2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium (PubChem CID 167430598) has the molecular formula C23H32NO2+ and a molecular weight of 354.51 g/mol. Its IUPAC name is [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium.
| Compound Name | [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium |
|---|---|
| PubChem CID | 167430598 |
| Molecular Formula | C23H32NO2+ |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [2,3-bis(2-methylpropyl)benzoyl]-dimethyl-phenoxyazanium |
| SMILES | CC(C)Cc1cccc(C(=O)[N+](C)(C)Oc2ccccc2)c1CC(C)C |
| InChI | InChI=1S/C23H32NO2/c1-17(2)15-19-11-10-14-21(22(19)16-18(3)4)23(25)24(5,6)26-20-12-8-7-9-13-20/h7-14,17-18H,15-16H2,1-6H3/q+1 |
| InChIKey | YJNLUOGRZOHTNX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|