C27H24N4O3 — CID 16743118
(2E)-2-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-(4-methoxyphenyl)-4-oxobutanehydrazide (PubChem CID 16743118) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is (2E)-2-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-(4-methoxyphenyl)-4-oxobutanehydrazide.
| Compound Name | (2E)-2-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-(4-methoxyphenyl)-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 16743118 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (2E)-2-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-(4-methoxyphenyl)-4-oxobutanehydrazide |
| SMILES | COc1ccc(C(=O)C/C(=C\c2cn(-c3ccccc3)nc2-c2ccccc2)C(=O)NN)cc1 |
| InChI | InChI=1S/C27H24N4O3/c1-34-24-14-12-19(13-15-24)25(32)17-21(27(33)29-28)16-22-18-31(23-10-6-3-7-11-23)30-26(22)20-8-4-2-5-9-20/h2-16,18H,17,28H2,1H3,(H,29,33)/b21-16+ |
| InChIKey | WRPVPXCEDOOMLA-LTGZKZEYSA-N |
| XLogP | 4.19 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|