C18H27ClN4O — CID 167431537
N-(6-chloropyridazin-3-yl)-2-(2,2-dimethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 167431537) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is N-(6-chloropyridazin-3-yl)-2-(2,2-dimethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | N-(6-chloropyridazin-3-yl)-2-(2,2-dimethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 167431537 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-(6-chloropyridazin-3-yl)-2-(2,2-dimethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CC1(C)CC(N2CC3CC(Nc4ccc(Cl)nn4)CC3C2)CCO1 |
| InChI | InChI=1S/C18H27ClN4O/c1-18(2)9-15(5-6-24-18)23-10-12-7-14(8-13(12)11-23)20-17-4-3-16(19)21-22-17/h3-4,12-15H,5-11H2,1-2H3,(H,20,22) |
| InChIKey | HRCKYNFGZZSDCM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |