C26H34ClFN4O — CID 166793738
(3aS,6aR)-N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-(2,2,6,6-tetramethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 166793738) has the molecular formula C26H34ClFN4O and a molecular weight of 473.04 g/mol. Its IUPAC name is (3aS,6aR)-N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-(2,2,6,6-tetramethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aR)-N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-(2,2,6,6-tetramethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 166793738 |
| Molecular Formula | C26H34ClFN4O |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (3aS,6aR)-N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-(2,2,6,6-tetramethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CC1(C)CC(N2C[C@H]3CC(Nc4ccc(-c5cc(F)ccc5Cl)nn4)C[C@H]3C2)CC(C)(C)O1 |
| InChI | InChI=1S/C26H34ClFN4O/c1-25(2)12-20(13-26(3,4)33-25)32-14-16-9-19(10-17(16)15-32)29-24-8-7-23(30-31-24)21-11-18(28)5-6-22(21)27/h5-8,11,16-17,19-20H,9-10,12-15H2,1-4H3,(H,29,31)/t16-,17+,19? |
| InChIKey | JIHNEVZZRGQILZ-JJTKIYQPSA-N |
| XLogP | 5.79 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |