C24H30F2N4O — CID 166806784
(3aS)-N-[6-(2,5-difluorophenyl)pyridazin-3-yl]-2-(2,2-dimethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 166806784) has the molecular formula C24H30F2N4O and a molecular weight of 428.53 g/mol. Its IUPAC name is (3aS)-N-[6-(2,5-difluorophenyl)pyridazin-3-yl]-2-(2,2-dimethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS)-N-[6-(2,5-difluorophenyl)pyridazin-3-yl]-2-(2,2-dimethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 166806784 |
| Molecular Formula | C24H30F2N4O |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (3aS)-N-[6-(2,5-difluorophenyl)pyridazin-3-yl]-2-(2,2-dimethyloxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CC1(C)CC(N2CC3CC(Nc4ccc(-c5cc(F)ccc5F)nn4)C[C@@H]3C2)CCO1 |
| InChI | InChI=1S/C24H30F2N4O/c1-24(2)12-19(7-8-31-24)30-13-15-9-18(10-16(15)14-30)27-23-6-5-22(28-29-23)20-11-17(25)3-4-21(20)26/h3-6,11,15-16,18-19H,7-10,12-14H2,1-2H3,(H,27,29)/t15-,16?,18?,19?/m1/s1 |
| InChIKey | QDZOIBNXSVBXNP-GMAZCVHMSA-N |
| XLogP | 4.50 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |