C24H31FN4O — CID 168795037
3-[(4S)-2,2-dimethyloxan-4-yl]-2-[6-(4-fluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 168795037) has the molecular formula C24H31FN4O and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-[(4S)-2,2-dimethyloxan-4-yl]-2-[6-(4-fluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | 3-[(4S)-2,2-dimethyloxan-4-yl]-2-[6-(4-fluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 168795037 |
| Molecular Formula | C24H31FN4O |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 3-[(4S)-2,2-dimethyloxan-4-yl]-2-[6-(4-fluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CC1(C)C[C@@H](C2C3CC(N)CC3CN2c2ccc(-c3ccc(F)cc3)nn2)CCO1 |
| InChI | InChI=1S/C24H31FN4O/c1-24(2)13-16(9-10-30-24)23-20-12-19(26)11-17(20)14-29(23)22-8-7-21(27-28-22)15-3-5-18(25)6-4-15/h3-8,16-17,19-20,23H,9-14,26H2,1-2H3/t16-,17?,19?,20?,23?/m0/s1 |
| InChIKey | BZQFASXZTWAUJL-YUVFIBLFSA-N |
| XLogP | 4.03 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |