C27H33B2F3N4O — CID 174064214
CID 174064214 (PubChem CID 174064214) has the molecular formula C27H33B2F3N4O and a molecular weight of 508.21 g/mol.
| Compound Name | CID 174064214 |
|---|---|
| PubChem CID | 174064214 |
| Molecular Formula | C27H33B2F3N4O |
| Molecular Weight | 508.21 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C1CC(C)(C)OC(C)(C)C1)N1C[C@H]2CC(Nc3ccc(-c4cc(F)cc(F)c4F)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C27H33B2F3N4O/c1-25(2)11-17(12-26(3,4)37-25)27(28,29)36-13-15-7-19(8-16(15)14-36)33-23-6-5-22(34-35-23)20-9-18(30)10-21(31)24(20)32/h5-6,9-10,15-17,19H,7-8,11-14H2,1-4H3,(H,33,35)/t15-,16+,19? |
| InChIKey | MWEGPSPHDSYLCK-MCPYQZEQSA-N |
| XLogP | 4.66 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.21 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|