C16H19NO3 — CID 167431770
1-[1-(1,3-benzodioxol-5-yl)ethenyl]azocan-2-one (PubChem CID 167431770) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)ethenyl]azocan-2-one.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)ethenyl]azocan-2-one |
|---|---|
| PubChem CID | 167431770 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)ethenyl]azocan-2-one |
| SMILES | C=C(c1ccc2c(c1)OCO2)N1CCCCCCC1=O |
| InChI | InChI=1S/C16H19NO3/c1-12(17-9-5-3-2-4-6-16(17)18)13-7-8-14-15(10-13)20-11-19-14/h7-8,10H,1-6,9,11H2 |
| InChIKey | MVCZXYZLZFKABA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |