C10H16N4O9S2 — CID 167432346
methyl 2-[(Z)-[amino-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]amino]sulfonylacetate (PubChem CID 167432346) has the molecular formula C10H16N4O9S2 and a molecular weight of 400.39 g/mol. Its IUPAC name is methyl 2-[(Z)-[amino-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]amino]sulfonylacetate.
| Compound Name | methyl 2-[(Z)-[amino-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]amino]sulfonylacetate |
|---|---|
| PubChem CID | 167432346 |
| Molecular Formula | C10H16N4O9S2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | methyl 2-[(Z)-[amino-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]amino]sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)/N=C(\N)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H16N4O9S2/c1-22-8(15)5-24(17,18)12-9(11)7-3-2-6-4-13(7)10(16)14(6)23-25(19,20)21/h6-7H,2-5H2,1H3,(H2,11,12)(H,19,20,21)/t6-,7+/m1/s1 |
| InChIKey | HQAUBZBPCIHZHS-RQJHMYQMSA-N |
| XLogP | -2.15 |
| TPSA | 185.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|