C10H23N2O4P — CID 167433564
(2-amino-2-hydroxyiminoethyl)-(6-methylheptoxy)phosphinic acid (PubChem CID 167433564) has the molecular formula C10H23N2O4P and a molecular weight of 266.28 g/mol. Its IUPAC name is (2-amino-2-hydroxyiminoethyl)-(6-methylheptoxy)phosphinic acid.
| Compound Name | (2-amino-2-hydroxyiminoethyl)-(6-methylheptoxy)phosphinic acid |
|---|---|
| PubChem CID | 167433564 |
| Molecular Formula | C10H23N2O4P |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2-amino-2-hydroxyiminoethyl)-(6-methylheptoxy)phosphinic acid |
| SMILES | CC(C)CCCCCOP(=O)(O)CC(N)=NO |
| InChI | InChI=1S/C10H23N2O4P/c1-9(2)6-4-3-5-7-16-17(14,15)8-10(11)12-13/h9,13H,3-8H2,1-2H3,(H2,11,12)(H,14,15) |
| InChIKey | WVMPCISJBZDVGD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|