C10H9F6NO3S — CID 167435003
difluoro-[2,3,5,6-tetrafluoro-4-(propylamino)phenyl]methanesulfonic acid (PubChem CID 167435003) has the molecular formula C10H9F6NO3S and a molecular weight of 337.24 g/mol. Its IUPAC name is difluoro-[2,3,5,6-tetrafluoro-4-(propylamino)phenyl]methanesulfonic acid.
| Compound Name | difluoro-[2,3,5,6-tetrafluoro-4-(propylamino)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 167435003 |
| Molecular Formula | C10H9F6NO3S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | difluoro-[2,3,5,6-tetrafluoro-4-(propylamino)phenyl]methanesulfonic acid |
| SMILES | CCCNc1c(F)c(F)c(C(F)(F)S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C10H9F6NO3S/c1-2-3-17-9-7(13)5(11)4(6(12)8(9)14)10(15,16)21(18,19)20/h17H,2-3H2,1H3,(H,18,19,20) |
| InChIKey | OUPYJACQSQCBOS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|