C9H6F7N — CID 14400543
N-ethyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline (PubChem CID 14400543) has the molecular formula C9H6F7N and a molecular weight of 261.14 g/mol. Its IUPAC name is N-ethyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline.
| Compound Name | N-ethyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 14400543 |
| Molecular Formula | C9H6F7N |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | N-ethyl-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| SMILES | CCNc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C9H6F7N/c1-2-17-8-6(12)4(10)3(9(14,15)16)5(11)7(8)13/h17H,2H2,1H3 |
| InChIKey | VPDTWBTUIHZJCS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|