C22H20F5N — CID 167440974
(3aS,9bR)-9b-methyl-3a-(2,2,3,3,3-pentafluoropropyl)-5-phenyl-2,3-dihydro-1H-cyclopenta[c]isoquinoline (PubChem CID 167440974) has the molecular formula C22H20F5N and a molecular weight of 393.40 g/mol. Its IUPAC name is (3aS,9bR)-9b-methyl-3a-(2,2,3,3,3-pentafluoropropyl)-5-phenyl-2,3-dihydro-1H-cyclopenta[c]isoquinoline.
| Compound Name | (3aS,9bR)-9b-methyl-3a-(2,2,3,3,3-pentafluoropropyl)-5-phenyl-2,3-dihydro-1H-cyclopenta[c]isoquinoline |
|---|---|
| PubChem CID | 167440974 |
| Molecular Formula | C22H20F5N |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (3aS,9bR)-9b-methyl-3a-(2,2,3,3,3-pentafluoropropyl)-5-phenyl-2,3-dihydro-1H-cyclopenta[c]isoquinoline |
| SMILES | C[C@]12CCC[C@@]1(CC(F)(F)C(F)(F)F)N=C(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C22H20F5N/c1-19-12-7-13-20(19,14-21(23,24)22(25,26)27)28-18(15-8-3-2-4-9-15)16-10-5-6-11-17(16)19/h2-6,8-11H,7,12-14H2,1H3/t19-,20+/m1/s1 |
| InChIKey | KXKITRRBMBKHBI-UXHICEINSA-N |
| XLogP | 6.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|