C22H21F2MnN4O2 — CID 167448788
3,3-difluoropentane;manganese(3+);N-[5-[5-(oxomethyl)pyrrolo[2,3-b]pyridin-1-yl]-3-pyridinyl]cyclopropanecarboxamide (PubChem CID 167448788) has the molecular formula C22H21F2MnN4O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is 3,3-difluoropentane;manganese(3+);N-[5-[5-(oxomethyl)pyrrolo[2,3-b]pyridin-1-yl]-3-pyridinyl]cyclopropanecarboxamide.
| Compound Name | 3,3-difluoropentane;manganese(3+);N-[5-[5-(oxomethyl)pyrrolo[2,3-b]pyridin-1-yl]-3-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167448788 |
| Molecular Formula | C22H21F2MnN4O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 3,3-difluoropentane;manganese(3+);N-[5-[5-(oxomethyl)pyrrolo[2,3-b]pyridin-1-yl]-3-pyridinyl]cyclopropanecarboxamide |
| SMILES | O=[C-]c1cnc2c(ccn2-c2cncc(NC(=O)C3CC3)c2)c1.[CH2-]CC(F)(F)C[CH2-].[Mn+3] |
| InChI | InChI=1S/C17H13N4O2.C5H8F2.Mn/c22-10-11-5-13-3-4-21(16(13)19-7-11)15-6-14(8-18-9-15)20-17(23)12-1-2-12;1-3-5(6,7)4-2;/h3-9,12H,1-2H2,(H,20,23);1-4H2;/q-1;-2;+3 |
| InChIKey | HZNUWQRFJDXFPA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|