C19H20F2N4O2 — CID 167450660
N-[(E)-(4,4-difluorocyclohexyl)methylideneamino]-6-(4-methoxyphenyl)pyrazine-2-carboxamide (PubChem CID 167450660) has the molecular formula C19H20F2N4O2 and a molecular weight of 374.39 g/mol. Its IUPAC name is N-[(E)-(4,4-difluorocyclohexyl)methylideneamino]-6-(4-methoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | N-[(E)-(4,4-difluorocyclohexyl)methylideneamino]-6-(4-methoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167450660 |
| Molecular Formula | C19H20F2N4O2 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[(E)-(4,4-difluorocyclohexyl)methylideneamino]-6-(4-methoxyphenyl)pyrazine-2-carboxamide |
| SMILES | COc1ccc(-c2cncc(C(=O)N/N=C/C3CCC(F)(F)CC3)n2)cc1 |
| InChI | InChI=1S/C19H20F2N4O2/c1-27-15-4-2-14(3-5-15)16-11-22-12-17(24-16)18(26)25-23-10-13-6-8-19(20,21)9-7-13/h2-5,10-13H,6-9H2,1H3,(H,25,26)/b23-10+ |
| InChIKey | DBFUCPYWXFGTRE-AUEPDCJTSA-N |
| XLogP | 3.69 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|