C18H18N2O4Si — CID 167454940
7-nitro-3-phenyl-2-trimethylsilyl-1H-indole-5-carboxylic acid (PubChem CID 167454940) has the molecular formula C18H18N2O4Si and a molecular weight of 354.44 g/mol. Its IUPAC name is 7-nitro-3-phenyl-2-trimethylsilyl-1H-indole-5-carboxylic acid.
| Compound Name | 7-nitro-3-phenyl-2-trimethylsilyl-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 167454940 |
| Molecular Formula | C18H18N2O4Si |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 7-nitro-3-phenyl-2-trimethylsilyl-1H-indole-5-carboxylic acid |
| SMILES | C[Si](C)(C)c1[nH]c2c([N+](=O)[O-])cc(C(=O)O)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C18H18N2O4Si/c1-25(2,3)17-15(11-7-5-4-6-8-11)13-9-12(18(21)22)10-14(20(23)24)16(13)19-17/h4-10,19H,1-3H3,(H,21,22) |
| InChIKey | RKWDMCWHHUGWCN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|