About 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate
4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate (PubChem CID 16745661) has the molecular formula C19H20O8
and a molecular weight of 376.36 g/mol. Its IUPAC name is 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate |
| PubChem CID | 16745661 |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate |
| SMILES | COC/C=C/C1=CC2=CC(=O)C(C)(OC(=O)CCC(=O)OC)C(=O)C2=CO1 |
| InChI | InChI=1S/C19H20O8/c1-19(27-17(22)7-6-16(21)25-3)15(20)10-12-9-13(5-4-8-24-2)26-11-14(12)18(19)23/h4-5,9-11H,6-8H2,1-3H3/b5-4+ |
| InChIKey | WYRVXUZELYCAMB-SNAWJCMRSA-N |
| XLogP | 1.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate?
The IUPAC name of 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate (CID 16745661) is 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate?
The canonical SMILES for 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate is COC/C=C/C1=CC2=CC(=O)C(C)(OC(=O)CCC(=O)OC)C(=O)C2=CO1.
What is the InChIKey of 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate?
The InChIKey is WYRVXUZELYCAMB-SNAWJCMRSA-N. The full InChI is InChI=1S/C19H20O8/c1-19(27-17(22)7-6-16(21)25-3)15(20)10-12-9-13(5-4-8-24-2)26-11-14(12)18(19)23/h4-5,9-11H,6-8H2,1-3H3/b5-4+.
What are the key properties of 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate?
4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate has a molecular weight of 376.36 g/mol, XLogP of 1.32, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[3-[(E)-3-methoxyprop-1-enyl]-7-methyl-6,8-dioxoisochromen-7-yl] 1-O-methyl butanedioate is sourced from PubChem (CID 16745661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).