C16H22ClN3O3 — CID 167460883
cis-(1R,3S)-3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1-carbaldehyde;2-methoxypropan-2-ol (PubChem CID 167460883) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is cis-(1R,3S)-3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1-carbaldehyde;2-methoxypropan-2-ol.
| Compound Name | cis-(1R,3S)-3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1-carbaldehyde;2-methoxypropan-2-ol |
|---|---|
| PubChem CID | 167460883 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | cis-(1R,3S)-3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1-carbaldehyde;2-methoxypropan-2-ol |
| SMILES | COC(C)(C)O.O=C[C@@H]1CC[C@H](n2ccc3c(Cl)ncnc32)C1 |
| InChI | InChI=1S/C12H12ClN3O.C4H10O2/c13-11-10-3-4-16(12(10)15-7-14-11)9-2-1-8(5-9)6-17;1-4(2,5)6-3/h3-4,6-9H,1-2,5H2;5H,1-3H3/t8-,9+;/m1./s1 |
| InChIKey | YWOYGOXMPDYVTP-RJUBDTSPSA-N |
| XLogP | 2.99 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|