C3H6ClNO2SZn — CID 16747163
zinc;(2S)-2-amino-3-sulfanylpropanoate;chloride (PubChem CID 16747163) has the molecular formula C3H6ClNO2SZn and a molecular weight of 221.00 g/mol. Its IUPAC name is zinc;(2S)-2-amino-3-sulfanylpropanoate;chloride.
| Compound Name | zinc;(2S)-2-amino-3-sulfanylpropanoate;chloride |
|---|---|
| PubChem CID | 16747163 |
| Molecular Formula | C3H6ClNO2SZn |
| Molecular Weight | 221.00 g/mol |
| Exact Mass | 218.91 |
| IUPAC Name | zinc;(2S)-2-amino-3-sulfanylpropanoate;chloride |
| SMILES | N[C@H](CS)C(=O)[O-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C3H7NO2S.ClH.Zn/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H;/q;;+2/p-2/t2-;;/m1../s1 |
| InChIKey | ZACWWEXAGRDPTH-YBBRRFGFSA-L |
| XLogP | -5.01 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.00 |
| LogP ≤ 5 | -5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|