About zinc;2-amino-3-sulfidopropanoate;hydrochloride
zinc;2-amino-3-sulfidopropanoate;hydrochloride (PubChem CID 85144932) has the molecular formula C3H6ClNO2SZn
and a molecular weight of 221.00 g/mol. Its IUPAC name is zinc;2-amino-3-sulfidopropanoate;hydrochloride.
Molecular Properties
| Compound Name | zinc;2-amino-3-sulfidopropanoate;hydrochloride |
| PubChem CID | 85144932 |
| Molecular Formula | C3H6ClNO2SZn |
| Molecular Weight | 221.00 g/mol |
| Exact Mass | 218.91 |
| IUPAC Name | zinc;2-amino-3-sulfidopropanoate;hydrochloride |
| SMILES | Cl.NC(C[S-])C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C3H7NO2S.ClH.Zn/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H;/q;;+2/p-2 |
| InChIKey | ZACWWEXAGRDPTH-UHFFFAOYSA-L |
| XLogP | -1.97 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.00 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-amino-3-sulfidopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-amino-3-sulfidopropanoate;hydrochloride?
The IUPAC name of zinc;2-amino-3-sulfidopropanoate;hydrochloride (CID 85144932) is zinc;2-amino-3-sulfidopropanoate;hydrochloride.
What is the SMILES notation for zinc;2-amino-3-sulfidopropanoate;hydrochloride?
The canonical SMILES for zinc;2-amino-3-sulfidopropanoate;hydrochloride is Cl.NC(C[S-])C(=O)[O-].[Zn+2].
What is the InChIKey of zinc;2-amino-3-sulfidopropanoate;hydrochloride?
The InChIKey is ZACWWEXAGRDPTH-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H7NO2S.ClH.Zn/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H;/q;;+2/p-2.
What are the key properties of zinc;2-amino-3-sulfidopropanoate;hydrochloride?
zinc;2-amino-3-sulfidopropanoate;hydrochloride has a molecular weight of 221.00 g/mol, XLogP of -1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-amino-3-sulfidopropanoate;hydrochloride is sourced from PubChem (CID 85144932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).