C13H13NOSe — CID 167475275
3-(2,3-dihydroselenophen-5-ylmethyl)-1H-indol-5-ol (PubChem CID 167475275) has the molecular formula C13H13NOSe and a molecular weight of 278.21 g/mol. Its IUPAC name is 3-(2,3-dihydroselenophen-5-ylmethyl)-1H-indol-5-ol.
| Compound Name | 3-(2,3-dihydroselenophen-5-ylmethyl)-1H-indol-5-ol |
|---|---|
| PubChem CID | 167475275 |
| Molecular Formula | C13H13NOSe |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 3-(2,3-dihydroselenophen-5-ylmethyl)-1H-indol-5-ol |
| SMILES | Oc1ccc2[nH]cc(CC3=CCC[Se]3)c2c1 |
| InChI | InChI=1S/C13H13NOSe/c15-10-3-4-13-12(7-10)9(8-14-13)6-11-2-1-5-16-11/h2-4,7-8,14-15H,1,5-6H2 |
| InChIKey | VIVTYJOPWBTZGB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|