C22H24N4O5S2 — CID 167476307
4-[[2-(3-anilinopiperidin-1-yl)-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid (PubChem CID 167476307) has the molecular formula C22H24N4O5S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 4-[[2-(3-anilinopiperidin-1-yl)-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[2-(3-anilinopiperidin-1-yl)-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476307 |
| Molecular Formula | C22H24N4O5S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 4-[[2-(3-anilinopiperidin-1-yl)-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NS(=O)(=O)c1csc(N2CCCC(Nc3ccccc3)C2)n1 |
| InChI | InChI=1S/C22H24N4O5S2/c1-31-19-12-15(21(27)28)9-10-18(19)25-33(29,30)20-14-32-22(24-20)26-11-5-8-17(13-26)23-16-6-3-2-4-7-16/h2-4,6-7,9-10,12,14,17,23,25H,5,8,11,13H2,1H3,(H,27,28) |
| InChIKey | ZMUOIGLGKQPVDE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |