C20H27N3O3 — CID 16748676
(3R)-6-cyclohexyl-N-hydroxy-3-(3-phenyl-1,2,4-oxadiazol-5-yl)hexanamide (PubChem CID 16748676) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (3R)-6-cyclohexyl-N-hydroxy-3-(3-phenyl-1,2,4-oxadiazol-5-yl)hexanamide.
| Compound Name | (3R)-6-cyclohexyl-N-hydroxy-3-(3-phenyl-1,2,4-oxadiazol-5-yl)hexanamide |
|---|---|
| PubChem CID | 16748676 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (3R)-6-cyclohexyl-N-hydroxy-3-(3-phenyl-1,2,4-oxadiazol-5-yl)hexanamide |
| SMILES | O=C(C[C@@H](CCCC1CCCCC1)c1nc(-c2ccccc2)no1)NO |
| InChI | InChI=1S/C20H27N3O3/c24-18(22-25)14-17(13-7-10-15-8-3-1-4-9-15)20-21-19(23-26-20)16-11-5-2-6-12-16/h2,5-6,11-12,15,17,25H,1,3-4,7-10,13-14H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | JRGFKVWNNKXSGS-QGZVFWFLSA-N |
| XLogP | 4.47 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|