C16H20NO6P — CID 167491390
2-(4,5-dihydroxy-6-quinolin-6-yloxyoxan-2-yl)ethylphosphonous acid (PubChem CID 167491390) has the molecular formula C16H20NO6P and a molecular weight of 353.31 g/mol. Its IUPAC name is 2-(4,5-dihydroxy-6-quinolin-6-yloxyoxan-2-yl)ethylphosphonous acid.
| Compound Name | 2-(4,5-dihydroxy-6-quinolin-6-yloxyoxan-2-yl)ethylphosphonous acid |
|---|---|
| PubChem CID | 167491390 |
| Molecular Formula | C16H20NO6P |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-(4,5-dihydroxy-6-quinolin-6-yloxyoxan-2-yl)ethylphosphonous acid |
| SMILES | OC1CC(CCP(O)O)OC(Oc2ccc3ncccc3c2)C1O |
| InChI | InChI=1S/C16H20NO6P/c18-14-9-12(5-7-24(20)21)23-16(15(14)19)22-11-3-4-13-10(8-11)2-1-6-17-13/h1-4,6,8,12,14-16,18-21H,5,7,9H2 |
| InChIKey | OHUODPXOBZMREE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|