C28H40F2N2O3Si — CID 167508469
tert-butyl 4-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]piperazine-1-carboxylate (PubChem CID 167508469) has the molecular formula C28H40F2N2O3Si and a molecular weight of 518.72 g/mol. Its IUPAC name is tert-butyl 4-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167508469 |
| Molecular Formula | C28H40F2N2O3Si |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | tert-butyl 4-[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(F)(F)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C28H40F2N2O3Si/c1-26(2,3)35-25(33)32-19-17-31(18-20-32)21-28(29,30)22-34-36(27(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16H,17-22H2,1-6H3 |
| InChIKey | VTXSRSZXGDGZEI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|