C11H23N3 — CID 167510563
ethane;N-ethyl-4,4,6-trimethyl-1,3-dihydropyrimidin-2-imine (PubChem CID 167510563) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is ethane;N-ethyl-4,4,6-trimethyl-1,3-dihydropyrimidin-2-imine.
| Compound Name | ethane;N-ethyl-4,4,6-trimethyl-1,3-dihydropyrimidin-2-imine |
|---|---|
| PubChem CID | 167510563 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | ethane;N-ethyl-4,4,6-trimethyl-1,3-dihydropyrimidin-2-imine |
| SMILES | CC.CC/N=C1\NC(C)=CC(C)(C)N1 |
| InChI | InChI=1S/C9H17N3.C2H6/c1-5-10-8-11-7(2)6-9(3,4)12-8;1-2/h6H,5H2,1-4H3,(H2,10,11,12);1-2H3 |
| InChIKey | FSJYEQIGAFMRAS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|