About but-1-ene;ethane;4-methylpiperazin-1-amine
but-1-ene;ethane;4-methylpiperazin-1-amine (PubChem CID 167513278) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is but-1-ene;ethane;4-methylpiperazin-1-amine.
Molecular Properties
| Compound Name | but-1-ene;ethane;4-methylpiperazin-1-amine |
| PubChem CID | 167513278 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | but-1-ene;ethane;4-methylpiperazin-1-amine |
| SMILES | C=CCC.CC.CN1CCN(N)CC1 |
| InChI | InChI=1S/C5H13N3.C4H8.C2H6/c1-7-2-4-8(6)5-3-7;1-3-4-2;1-2/h2-6H2,1H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | SXAIGKXFQZFHRA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;ethane;4-methylpiperazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;ethane;4-methylpiperazin-1-amine?
The IUPAC name of but-1-ene;ethane;4-methylpiperazin-1-amine (CID 167513278) is but-1-ene;ethane;4-methylpiperazin-1-amine.
What is the SMILES notation for but-1-ene;ethane;4-methylpiperazin-1-amine?
The canonical SMILES for but-1-ene;ethane;4-methylpiperazin-1-amine is C=CCC.CC.CN1CCN(N)CC1.
What is the InChIKey of but-1-ene;ethane;4-methylpiperazin-1-amine?
The InChIKey is SXAIGKXFQZFHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3.C4H8.C2H6/c1-7-2-4-8(6)5-3-7;1-3-4-2;1-2/h2-6H2,1H3;3H,1,4H2,2H3;1-2H3.
What are the key properties of but-1-ene;ethane;4-methylpiperazin-1-amine?
but-1-ene;ethane;4-methylpiperazin-1-amine has a molecular weight of 201.36 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;ethane;4-methylpiperazin-1-amine is sourced from PubChem (CID 167513278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).