C25H42 — CID 167515438
1-ethyl-2,4-dimethyl-5-(10-methyldodecyl)-3,6-dimethylidenecyclohexa-1,4-diene (PubChem CID 167515438) has the molecular formula C25H42 and a molecular weight of 342.61 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethyl-5-(10-methyldodecyl)-3,6-dimethylidenecyclohexa-1,4-diene.
| Compound Name | 1-ethyl-2,4-dimethyl-5-(10-methyldodecyl)-3,6-dimethylidenecyclohexa-1,4-diene |
|---|---|
| PubChem CID | 167515438 |
| Molecular Formula | C25H42 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | 1-ethyl-2,4-dimethyl-5-(10-methyldodecyl)-3,6-dimethylidenecyclohexa-1,4-diene |
| SMILES | C=c1c(C)c(CC)c(=C)c(CCCCCCCCCC(C)CC)c1C |
| InChI | InChI=1S/C25H42/c1-8-19(3)17-15-13-11-10-12-14-16-18-25-22(6)20(4)21(5)24(9-2)23(25)7/h19H,4,7-18H2,1-3,5-6H3 |
| InChIKey | XYYFJZOTZCZWFC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|