C24H20ClN5O3S2 — CID 167529818
4-chloro-N-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2-pyridinyl]amino]ethyl]benzenesulfonamide (PubChem CID 167529818) has the molecular formula C24H20ClN5O3S2 and a molecular weight of 526.04 g/mol. Its IUPAC name is 4-chloro-N-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2-pyridinyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2-pyridinyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167529818 |
| Molecular Formula | C24H20ClN5O3S2 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 4-chloro-N-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2-pyridinyl]amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(-c2c(-c3cccc(O)c3)nc3sccn23)ccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClN5O3S2/c25-18-4-6-20(7-5-18)35(32,33)28-11-10-27-21-15-17(8-9-26-21)23-22(16-2-1-3-19(31)14-16)29-24-30(23)12-13-34-24/h1-9,12-15,28,31H,10-11H2,(H,26,27) |
| InChIKey | GWFHLSAGPPQUQS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|