C25H31F3N2O3 — CID 167550000
tert-butyl 3-[(3S)-1-[6-amino-2-methyl-3-(2,4,6-trifluorophenoxy)phenyl]piperidin-3-yl]propanoate (PubChem CID 167550000) has the molecular formula C25H31F3N2O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is tert-butyl 3-[(3S)-1-[6-amino-2-methyl-3-(2,4,6-trifluorophenoxy)phenyl]piperidin-3-yl]propanoate.
| Compound Name | tert-butyl 3-[(3S)-1-[6-amino-2-methyl-3-(2,4,6-trifluorophenoxy)phenyl]piperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 167550000 |
| Molecular Formula | C25H31F3N2O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | tert-butyl 3-[(3S)-1-[6-amino-2-methyl-3-(2,4,6-trifluorophenoxy)phenyl]piperidin-3-yl]propanoate |
| SMILES | Cc1c(Oc2c(F)cc(F)cc2F)ccc(N)c1N1CCC[C@@H](CCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C25H31F3N2O3/c1-15-21(32-24-18(27)12-17(26)13-19(24)28)9-8-20(29)23(15)30-11-5-6-16(14-30)7-10-22(31)33-25(2,3)4/h8-9,12-13,16H,5-7,10-11,14,29H2,1-4H3/t16-/m0/s1 |
| InChIKey | CGWBJSLHGBDIJS-INIZCTEOSA-N |
| XLogP | 6.13 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|