C21H30N4O3S — CID 167556797
tert-butyl 4-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxybutanoate (PubChem CID 167556797) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is tert-butyl 4-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxybutanoate.
| Compound Name | tert-butyl 4-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxybutanoate |
|---|---|
| PubChem CID | 167556797 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl 4-[6-[(5-cyclobutyl-1,3-thiazol-2-yl)amino]-2-ethylpyrimidin-4-yl]oxybutanoate |
| SMILES | CCc1nc(Nc2ncc(C3CCC3)s2)cc(OCCCC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C21H30N4O3S/c1-5-16-23-17(25-20-22-13-15(29-20)14-8-6-9-14)12-18(24-16)27-11-7-10-19(26)28-21(2,3)4/h12-14H,5-11H2,1-4H3,(H,22,23,24,25) |
| InChIKey | XWHSIYTUKWBTQA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|